CymitQuimica logo

CAS 149914-81-8

:

(2-chlorophenyl)-cyclopropyl-methanone

Description:
(2-Chlorophenyl)-cyclopropyl-methanone, with the CAS number 149914-81-8, is an organic compound characterized by its unique structure that includes a cyclopropyl group and a chlorophenyl moiety. This compound typically exhibits properties associated with ketones, such as being a polar molecule due to the presence of the carbonyl group, which can influence its solubility in various solvents. The chlorophenyl group may impart additional reactivity and influence the compound's electronic properties, potentially making it a candidate for various chemical reactions, including electrophilic substitutions. The cyclopropyl ring contributes to the compound's strain and rigidity, which can affect its reactivity and stability. In terms of applications, compounds with similar structures are often explored in medicinal chemistry for their potential biological activities. However, specific data regarding its toxicity, environmental impact, and detailed physical properties would require further investigation or experimental data. Overall, (2-chlorophenyl)-cyclopropyl-methanone represents a compound of interest in organic synthesis and pharmaceutical research.
Formula:C10H9ClO
InChI:InChI=1/C10H9ClO/c11-9-4-2-1-3-8(9)10(12)7-5-6-7/h1-4,7H,5-6H2
SMILES:c1ccc(c(c1)C(=O)C1CC1)Cl
Synonyms:
  • Methanone, (2-Chlorophenyl)Cyclopropyl-
  • (2-Chlorophenyl)(cyclopropyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.