CymitQuimica logo

CAS 149930-92-7

:

BOC-D-2-AMINO-4-BROMO-4-PENTENOIC ACID

Description:
BOC-D-2-amino-4-bromo-4-pentenoic acid, with the CAS number 149930-92-7, is a chemical compound characterized by its unique structure, which includes a bromine atom and a pentenoic acid moiety. This compound features a tert-butyloxycarbonyl (BOC) protecting group on the amino group, which is commonly used in peptide synthesis to protect amines during chemical reactions. The presence of the bromine atom introduces a halogen functionality, which can enhance reactivity and facilitate further chemical modifications. The pentenoic acid portion of the molecule indicates that it possesses a double bond, contributing to its unsaturation and potential for various chemical transformations. This compound is typically utilized in organic synthesis and medicinal chemistry, particularly in the development of bioactive molecules. Its properties, such as solubility and stability, can vary depending on the solvent and conditions used in experiments. As with many chemical substances, proper handling and safety precautions are essential due to its potential reactivity and biological activity.
Formula:C10H16BrNO4
InChI:InChI=1S/C10H16BrNO4/c1-6(11)5-7(8(13)14)12-9(15)16-10(2,3)4/h7H,1,5H2,2-4H3,(H,12,15)(H,13,14)/t7-/m1/s1
InChI key:AKUQAUPMGSKZIY-SSDOTTSWSA-N
SMILES:CC(C)(C)OC(=O)N[C@H](CC(=C)Br)C(=O)O
Found 4 products.