CAS 149947-15-9

3-bromo-2-fluorobenzaldehyde

Description:

3-Bromo-2-fluorobenzaldehyde is an aromatic compound characterized by the presence of both bromine and fluorine substituents on a benzaldehyde ring. Specifically, the bromine atom is located at the meta position (3-position) and the fluorine atom at the ortho position (2-position) relative to the aldehyde functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity due to the presence of the aldehyde functional group, which can participate in various chemical reactions, including nucleophilic addition and condensation reactions. The presence of halogens like bromine and fluorine can influence the compound's electronic properties, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 3-bromo-2-fluorobenzaldehyde may exhibit unique spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization in laboratory settings.

Formula: C₇H₄BrFO

InChI: InChI=1/C7H4BrFO/c8-7-5(4-10)2-1-3-6(7)9/h1-4H

SMILES: c1cc(C=O)c(c(c1)F)Br

Benzaldehyde, 3-bromo-2-fluoro-

CAS: 149947-15-9

Formula: C₇H₄BrFO

Purity: 98%

Color and Shape: Solid

Molecular weight: 203.0085

Ref: IN-DA001M56

3-Bromo-2-fluorobenzaldehyde

CAS: 149947-15-9

Formula: C₇H₄BrFO

Purity: >98.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 203.01

Ref: 3B-B5363

3-Bromo-2-fluorobenzaldehyde

CAS: 149947-15-9

3-Bromo-2-fluorobenzaldehyde

Formula: C₇H₄BrFO

Purity: 98%

Color and Shape: white crystalline solid

Molecular weight: 203.01g/mol

Ref: 54-PC8581

3-Bromo-2-fluorobenzaldehyde

CAS: 149947-15-9

Formula: C₇H₄BrFO

Purity: 97%

Color and Shape: Solid, Crystalline Powder or Powder

Molecular weight: 203.01

Ref: 10-F065144