CAS 149965-92-4
:5-Fluorouridine-5'-O-b-D-galactopyranoside
Description:
5-Fluorouridine-5'-O-β-D-galactopyranoside is a nucleoside analog characterized by the presence of a fluorine atom at the 5-position of the uridine base, which is linked to a galactopyranoside moiety via a glycosidic bond. This compound exhibits properties typical of nucleosides, including the ability to participate in biochemical reactions involving nucleic acids. The fluorine substitution enhances its stability and can influence its biological activity, making it of interest in medicinal chemistry, particularly in the context of antiviral and anticancer research. The β-D-galactopyranoside component contributes to its solubility and potential interactions with biological systems, as glycosides often play roles in cellular recognition and signaling. Additionally, the compound may exhibit specific pharmacokinetic properties, influencing its absorption, distribution, metabolism, and excretion in biological systems. Overall, 5-Fluorouridine-5'-O-β-D-galactopyranoside represents a valuable structure for studying nucleoside function and developing therapeutic agents.
Formula:C15H21FN2O11
InChI:InChI=1/C15H21FN2O11/c16-4-1-18(15(26)17-12(4)25)13-10(23)8(21)6(28-13)3-27-14-11(24)9(22)7(20)5(2-19)29-14/h1,5-11,13-14,19-24H,2-3H2,(H,17,25,26)/t5-,6-,7+,8-,9+,10-,11-,13-,14-/m1/s1
Synonyms:- 5'-O-galactosyl-5-fluorouridine
- 5-fluoro-5'-O-beta-D-galactopyranosyluridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Fluorouridine-5'-O-b-D-galactopyranoside
CAS:Formula:C15H21FN2O11Purity:≥95%Molecular weight:424.33245-Fluorouridine 5'-O-β-D-galactopyranoside
CAS:5-Fluorouridine 5'-O-β-D-galactopyranoside, also known as 5'-O-β-D-galactosyl-5-fluorouridine, is a prodrug of 5-Fluorouridine.Formula:C15H21FN2O11Color and Shape:SolidMolecular weight:424.3345-Fluorouridine-5'-O-b-D-galactopyranoside
CAS:5-Fluorouridine-5'-O-b-D-galactopyranoside is a nucleoside that can be used as an activator to synthesize ribonucleosides and deoxyribonucleosides. This product is also an anticancer agent, as it inhibits cell proliferation by inactivating the enzyme DNA polymerase. It is highly purified, with a purity of 99%.Formula:C15H21FN2O11Purity:Min. 98 Area-%Color and Shape:Off-White PowderMolecular weight:424.33 g/mol5-Fluorouridine-5'-O-b-D-galactopyranoside
CAS:Controlled ProductFormula:C15H21FN2O11Color and Shape:NeatMolecular weight:424.332





