CAS 14997-54-7

Gabmtp

Description:

Gabmtp, with the CAS number 14997-54-7, is a chemical compound that belongs to the class of phosphonic acids. It is characterized by its unique molecular structure, which includes a phosphonate group that contributes to its reactivity and potential applications in various fields, including agriculture and materials science. Gabmtp is often studied for its role as a herbicide or plant growth regulator, exhibiting specific biological activity that can influence plant metabolism. The compound is typically soluble in water, which enhances its utility in agricultural formulations. Additionally, its stability under various environmental conditions makes it a candidate for further research in agrochemical applications. Safety and handling precautions are essential when working with Gabmtp, as with any chemical substance, to mitigate potential hazards associated with exposure. Overall, Gabmtp represents a significant area of interest in the study of phosphonic acid derivatives and their applications in enhancing agricultural productivity.

Formula: C₁₁H₁₈N₅O₁₃P₃

InChI: InChI=1/C11H18N5O13P3/c12-11-14-8-5(9(19)15-11)13-2-16(8)10-7(18)6(17)4(28-10)1-27-32(25,26)29-31(23,24)3-30(20,21)22/h2,4,6-7,10,17-18H,1,3H2,(H,23,24)(H,25,26)(H2,20,21,22)(H3,12,14,15,19)/t4-,6-,7-,10-/m1/s1

SMILES: C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c2[nH]c(=N)nc3O)O1)O)O)OP(=O)(O)OP(=O)(CP(=O)(O)O)O

Synonyms:

• Guanosine 5'-(Alpha,Beta-Methylene)Triphosphate

Guanosine-5'-[(a,beta)-methyleno]triphosphate sodium salt

CAS: 14997-54-7

Guanosine-5'-[(a,b)-methyleno]triphosphate sodium salt (GpCpp) is a non hydrolyzable nucleoside

Purity: Min. 95%

Ref: 3D-NG171069