CymitQuimica logo

CAS 149978-42-7

:

1-Methyl-5-(trifluoromethyl)-1H-pyrazol-3-amine

Description:
1-Methyl-5-(trifluoromethyl)-1H-pyrazol-3-amine is an organic compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a methyl group at the 1-position and a trifluoromethyl group at the 5-position significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The trifluoromethyl group imparts unique electronic properties, enhancing the compound's lipophilicity and potentially affecting its biological activity. 1-Methyl-5-(trifluoromethyl)-1H-pyrazol-3-amine may be utilized in various applications, including medicinal chemistry, where it could serve as a building block for the synthesis of pharmaceuticals or agrochemicals. Its specific interactions and stability can be influenced by environmental factors such as pH and temperature, making it an interesting subject for further research in both synthetic and applied chemistry contexts.
Formula:C5H6F3N3
InChI:InChI=1S/C5H6F3N3/c1-11-3(5(6,7)8)2-4(9)10-11/h2H,1H3,(H2,9,10)
InChI key:XIVVMPWSYHAGFP-UHFFFAOYSA-N
SMILES:CN1C(=CC(=N1)N)C(F)(F)F
Found 5 products.