CAS 149981-47-5
:1H-Purine-2,6-dione, 3-(2-furanylmethyl)-3,7-dihydro-1-methyl-8-(methyl-d3)-
Description:
1H-Purine-2,6-dione, 3-(2-furanylmethyl)-3,7-dihydro-1-methyl-8-(methyl-d3)-, identified by CAS number 149981-47-5, is a synthetic compound that belongs to the purine family, which is characterized by a bicyclic structure containing fused imidazole and pyrimidine rings. This compound features a furan moiety, which contributes to its unique chemical properties and potential biological activity. The presence of methyl groups, including deuterated methyl groups, suggests that it may be used in studies involving isotopic labeling, aiding in tracking metabolic pathways or interactions in biological systems. The dihydro form indicates that it may exist in a reduced state, which can influence its reactivity and stability. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting purine metabolism or related pathways. Its specific characteristics, such as solubility, melting point, and reactivity, would depend on its molecular structure and the functional groups present.
Formula:C12H9D3N4O3
InChI:InChI=1S/C12H12N4O3/c1-7-13-9-10(14-7)16(6-8-4-3-5-19-8)12(18)15(2)11(9)17/h3-5H,6H2,1-2H3,(H,13,14)/i1D3
InChI key:InChIKey=KGQZGCIVHYLPBH-FIBGUPNXSA-N
SMILES:C(N1C2=C(C(=O)N(C)C1=O)NC(C([2H])([2H])[2H])=N2)C3=CC=CO3
Synonyms:- 1H-Purine-2,6-dione, 3-(2-furanylmethyl)-3,7-dihydro-1-methyl-8-(methyl-d3)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
