CymitQuimica logo

CAS 149989-79-7

:

2-[(2-Bromophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-[(2-Bromophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane ring structure, which contains boron, oxygen, and carbon atoms. This compound features a bromophenyl group, contributing to its potential reactivity and applications in organic synthesis, particularly in cross-coupling reactions. The presence of the tetramethyl substituents enhances its stability and solubility in organic solvents. The dioxaborolane moiety is known for its ability to participate in various chemical transformations, including Suzuki-Miyaura coupling, making it valuable in the synthesis of complex organic molecules. Additionally, the bromine atom can serve as a leaving group, facilitating nucleophilic substitution reactions. Overall, this compound is of interest in medicinal chemistry and materials science due to its functional properties and versatility in synthetic applications. Its specific reactivity and applications can vary based on the surrounding chemical environment and reaction conditions.
Formula:C13H18BBrO2
InChI:InChI=1S/C13H18BBrO2/c1-12(2)13(3,4)17-14(16-12)9-10-7-5-6-8-11(10)15/h5-8H,9H2,1-4H3
InChI key:InChIKey=SJTVNJJAXZVOCQ-UHFFFAOYSA-N
SMILES:C(B1OC(C)(C)C(C)(C)O1)C2=C(Br)C=CC=C2
Synonyms:
  • 1,3,2-Dioxaborolane, 2-[(2-bromophenyl)methyl]-4,4,5,5-tetramethyl-
  • 2-(2-Bromobenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 2-[(2-Bromophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.