CAS 149990-50-1
:ocobullenone
Description:
Ocobullenone, identified by its CAS number 149990-50-1, is a synthetic organic compound that belongs to the class of chemical substances known as ketones. It is characterized by its unique molecular structure, which includes a carbonyl group (C=O) flanked by hydrocarbon chains. This compound is often studied for its potential applications in various fields, including materials science and organic synthesis. Ocobullenone may exhibit specific physical properties such as a distinct boiling point, melting point, and solubility characteristics, which can influence its behavior in chemical reactions and interactions with other substances. Additionally, its reactivity may be influenced by the presence of functional groups and the overall molecular geometry. While detailed information on its biological activity and toxicity may be limited, compounds in this category are often evaluated for their environmental impact and safety in industrial applications. Further research is necessary to fully understand the properties and potential uses of ocobullenone in various scientific and industrial contexts.
Formula:C21H22O6
InChI:InChI=1/C21H22O6/c1-4-5-20-9-21(17(8-16(20)22)25-11-27-21)12(2)18(20)13-6-14(23-3)19-15(7-13)24-10-26-19/h4,6-8,12,18H,1,5,9-11H2,2-3H3/t12-,18-,20+,21-/m1/s1
Synonyms:- (3aR,4R,5R,6R)-5-(7-methoxy-1,3-benzodioxol-5-yl)-4-methyl-6-(prop-2-en-1-yl)-5,6-dihydro-3a,6-methanocyclohepta[d][1,3]dioxol-7(4H)-one
- Ocobullenone
- 3a,6-Methano-7H-cyclohepta-1,3-dioxol-7-one, 3a,4,5,6-tetrahydro-5-(7-methoxy-1,3-benzodioxol-5-yl)-4-methyl-6-(2-propen-1-yl)-, (3aR,4R,5R,6R)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ocobullenone
CAS:Ocobullenone is an enzyme inhibitor.Formula:C21H22O6Color and Shape:SolidMolecular weight:370.4
