CAS 1500-85-2
:7-Deazaadenine
Description:
7-Deazaadenine is a purine derivative that is structurally similar to adenine, with the notable difference being the substitution of a nitrogen atom in the 7-position of the purine ring with a carbon atom. This modification imparts unique properties to the molecule, making it of interest in various biochemical and pharmaceutical applications. It is often utilized as a building block in nucleic acid synthesis and can serve as a substrate for certain enzymes, influencing nucleic acid metabolism. The compound exhibits solubility in polar solvents, which is typical for purine derivatives, and it can participate in hydrogen bonding due to the presence of amino and carbonyl functional groups. Additionally, 7-Deazaadenine has been studied for its potential role in the development of antiviral and anticancer agents, as it can affect cellular processes related to nucleic acid function. Its ability to mimic adenine while altering biological interactions makes it a valuable compound in medicinal chemistry and molecular biology research.
Formula:C6H6N4
InChI:InChI=1S/C6H6N4/c7-5-4-1-2-8-6(4)10-3-9-5/h1-3H,(H3,7,8,9,10)
InChI key:InChIKey=PEHVGBZKEYRQSX-UHFFFAOYSA-N
SMILES:NC1=C2C(=NC=N1)NC=C2
Synonyms:- 1H-Pyrrolo[2,3-d]pyrimidin-4-amine
- 1H-Pyrrolo[2,3-d]pyrimidine, 4-amino-
- 3-D)Pyrimidine,4-Amino-7H-Pyrrolo(
- 4-Aminopyrrolo[2,3-D]Pyrimidine
- 4-Aminopyrrolo[2,3-d]Pyrimidin
- 7-Deazaadenine
- 7H-Pyrrolo[2,3-D]Pyrimidin-4-Amine
- 7H-Pyrrolo[2,3-d]pyrimidine, 4-amino-
- 4-AMINO-7H-PYRROLO[2,3-D]PYRIMIDINE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
7H-Pyrrolo[2,3-d]pyrimidin-4-amine
CAS:Formula:C6H6N4Purity:>97.0%(T)(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:134.144-Amino-7H-pyrrolo[2,3-d]pyrimidine
CAS:Formula:C6H6N4Purity:98%Color and Shape:SolidMolecular weight:134.13864-Amino-7H-pyrrolo[2,3-d]pyrimidine
CAS:4-Amino-7H-pyrrolo[2,3-d]pyrimidineFormula:C6H6N4Purity:97%Color and Shape: pale brown solidMolecular weight:134.14g/mol7H-Pyrrolo[2,3-d]pyrimidin-4-amine
CAS:Formula:C6H6N4Purity:97%Color and Shape:SolidMolecular weight:134.1427-Deazaadenine
CAS:7-Deazaadenine is a pyrimidine compound that inhibits the enzyme kinase, which is involved in DNA synthesis. 7-Deazaadenine has significant cytotoxicity against cells and has been shown to inhibit the polymerase chain reaction (PCR). It can be used as an analytical tool for investigating enzymatic reactions by selectively inhibiting specific enzymes. 7-Deazaadenine binds to nitrogen atoms in DNA and inhibits the activity of proteases, which are enzymes that break down proteins. This drug also has pharmacokinetic properties such as oral absorption and distribution, metabolism, and elimination.
Formula:C6H6N4Purity:Min. 95%Molecular weight:134.14 g/mol





