CymitQuimica logo

CAS 150009-08-8

:

4-(2,2-dimethylpropanoyl)benzonitrile

Description:
4-(2,2-Dimethylpropanoyl)benzonitrile, identified by its CAS number 150009-08-8, is an organic compound characterized by its structural features, which include a benzonitrile moiety and a 2,2-dimethylpropanoyl group. This compound typically exhibits a crystalline solid form at room temperature and is likely to be soluble in organic solvents due to its hydrophobic nature. The presence of the nitrile functional group (-C≡N) suggests that it may participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, the compound's structure indicates potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Its molecular properties, such as melting point, boiling point, and reactivity, would be influenced by the steric effects of the bulky dimethylpropanoyl group. Safety data sheets would be essential for handling this compound, as it may pose health risks if inhaled or ingested. Overall, 4-(2,2-dimethylpropanoyl)benzonitrile is a notable compound in the realm of organic chemistry with potential utility in various applications.
Formula:C12H13NO
InChI:InChI=1/C12H13NO/c1-12(2,3)11(14)10-6-4-9(8-13)5-7-10/h4-7H,1-3H3
SMILES:CC(C)(C)C(=O)c1ccc(cc1)C#N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.