CAS 150010-20-1
:2-Bromo-5-methylpyrimidine
Description:
2-Bromo-5-methylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a bromine atom at the second position and a methyl group at the fifth position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its role as an intermediate in the synthesis of pharmaceuticals and agrochemicals, owing to the reactivity of the bromine substituent, which can participate in various nucleophilic substitution reactions. The presence of the methyl group can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules. 2-Bromo-5-methylpyrimidine is soluble in organic solvents, making it useful in various chemical reactions. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to the skin and eyes, and potential toxicity if ingested or inhaled. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety.
Formula:C5H5BrN2
InChI:InChI=1/C5H5BrN2/c1-4-2-7-5(6)8-3-4/h2-3H,1H3
SMILES:Cc1cnc(Br)nc1
Synonyms:- Pyrimidine, 2-Bromo-5-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pyrimidine, 2-bromo-5-methyl-
CAS:Formula:C5H5BrN2Purity:96%Color and Shape:SolidMolecular weight:173.01062-Bromo-5-methylpyrimidine
CAS:2-Bromo-5-methylpyrimidineFormula:C5H5BrN2Purity:95%Color and Shape: light brown to brown solidMolecular weight:173.01g/mol2-Bromo-5-methylpyrimidine
CAS:Formula:C5H5BrN2Purity:96%Color and Shape:SolidMolecular weight:173.0132-Bromo-5-methylpyrimidine
CAS:Please enquire for more information about 2-Bromo-5-methylpyrimidine including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C5H5BrN2Purity:95%NmrMolecular weight:173.01 g/mol



