CAS 150012-89-8

Ethyl 2-amino-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxylate

Description:

Ethyl 2-amino-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxylate, with the CAS number 150012-89-8, is a chemical compound characterized by its complex bicyclic structure, which includes an imidazo[1,2-a]pyridine moiety. This compound features an ethyl ester functional group and an amino group, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar organic solvents due to the presence of the carboxylate group. The compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its unique arrangement of nitrogen and carbon atoms may also impart interesting pharmacological properties, making it a subject of interest in medicinal chemistry. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound represents a fascinating intersection of organic chemistry and potential therapeutic applications.

Formula: C₁₀H₁₅N₃O₂

InChI: InChI=1S/C10H15N3O2/c1-2-15-10(14)8-9(11)12-7-5-3-4-6-13(7)8/h2-6,11H2,1H3

InChI key: InChIKey=ITIHVZMQASZKCT-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1N2C(=NC1N)CCCC2

Synonyms:

• 2-Amino-5,6,7,8-tetrahydro-imidazo[1,2-a]pyridine-3-carboxylic acid ethyl ester
• Imidazo[1,2-a]pyridine-3-carboxylic acid, 2-amino-5,6,7,8-tetrahydro-, ethyl ester
• Ethyl 2-amino-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxylate

2-Amino-5,6,7,8-tetrahydro-imidazo[1,2-a]pyridine-3-carboxylic acid ethyl ester

CAS: 150012-89-8

2-Amino-5,6,7,8-tetrahydro-imidazo[1,2-a]pyridine-3-carboxylic acid ethyl ester

Purity: ≥95%

Molecular weight: 209.25g/mol

Ref: 54-OR314044

Ethyl 2-amino-5H,6H,7H,8H-imidazo[1,2-a]pyridine-3-carboxylate

CAS: 150012-89-8

Versatile small molecule scaffold

Formula: C₁₀H₁₅N₃O₂

Purity: Min. 95%

Molecular weight: 209.24 g/mol

Ref: 3D-AGA01289