CAS 150018-99-8
:1-Benzyl-3-hydroxypiperidine-3-carbonitrile
Description:
1-Benzyl-3-hydroxypiperidine-3-carbonitrile is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of a benzyl group indicates that a phenyl ring is attached to a methylene (-CH2-) group, contributing to its hydrophobic properties. The hydroxyl (-OH) group at the 3-position of the piperidine ring suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The carbonitrile (-C≡N) functional group at the same position adds to its polarity and can participate in nucleophilic reactions. This compound may be of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. Its structural features suggest that it could interact with various biological targets, making it a candidate for further research in drug discovery. Additionally, the presence of multiple functional groups allows for diverse synthetic modifications, enhancing its utility in chemical synthesis and applications in various fields.
Formula:C13H16N2O
InChI:InChI=1/C13H16N2O/c14-10-13(16)7-4-8-15(11-13)9-12-5-2-1-3-6-12/h1-3,5-6,16H,4,7-9,11H2
SMILES:c1ccc(cc1)CN1CCCC(C#N)(C1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
