CAS 150026-72-5
:Methyl 2-[(3R)-3-[3-[(1E)-2-(7-chloro-2-quinolinyl)ethenyl]phenyl]-3-hydroxypropyl]benzoate
Description:
Methyl 2-[(3R)-3-[3-[(1E)-2-(7-chloro-2-quinolinyl)ethenyl]phenyl]-3-hydroxypropyl]benzoate, with CAS number 150026-72-5, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzoate ester functional group and a quinoline moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the chloro group and the quinoline structure suggests possible interactions with biological targets, which may contribute to its pharmacological effects. Additionally, the stereochemistry indicated by the (3R) configuration may influence its biological activity and interactions. As with many organic compounds, its stability, reactivity, and solubility can vary based on environmental conditions such as pH and temperature. Overall, this compound's unique structural features position it as a candidate for further investigation in medicinal chemistry and drug development.
Formula:C28H24ClNO3
InChI:InChI=1S/C28H24ClNO3/c1-33-28(32)25-8-3-2-6-20(25)12-16-27(31)22-7-4-5-19(17-22)9-14-24-15-11-21-10-13-23(29)18-26(21)30-24/h2-11,13-15,17-18,27,31H,12,16H2,1H3/b14-9+/t27-/m1/s1
InChI key:InChIKey=KPCSDMZEMDMWKQ-WKMZLRSWSA-N
SMILES:C(=C/C1=CC([C@@H](CCC2=C(C(OC)=O)C=CC=C2)O)=CC=C1)\C3=NC4=C(C=C3)C=CC(Cl)=C4
Synonyms:- Methyl 2-[(3R)-3-[3-[(1E)-2-(7-chloro-2-quinolinyl)ethenyl]phenyl]-3-hydroxypropyl]benzoate
- Benzoic acid, 2-[3-[3-[2-(7-chloro-2-quinolinyl)ethenyl]phenyl]-3-hydroxypropyl]-, methyl ester, [R-(E)]-
- Benzoic acid, 2-[(3R)-3-[3-[(1E)-2-(7-chloro-2-quinolinyl)ethenyl]phenyl]-3-hydroxypropyl]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Montelukast Impurity 3
CAS:Formula:C28H24ClNO3Color and Shape:Pale Yellow SolidMolecular weight:457.952-[3-(R)-[3-(2-(7-Chloro-2-quinolinyl)ethenyl)phenyl]-3-hydroxypropyl]benzoic Acid Methyl Ester
CAS:Controlled ProductFormula:C28H24ClNO3Color and Shape:Light Yellow To Light GreenMolecular weight:457.948


