CAS 150045-18-4

5,8-dihydroxy-3-methyl-4-(9H)-naphtho(2,3-c)furanone

Description:

5,8-Dihydroxy-3-methyl-4-(9H)-naphtho(2,3-c)furanone, with the CAS number 150045-18-4, is a chemical compound characterized by its complex polycyclic structure, which includes a naphthoquinone moiety. This compound features two hydroxyl groups at the 5 and 8 positions, contributing to its potential reactivity and solubility in various solvents. The presence of a methyl group at the 3 position further influences its chemical properties and biological activity. It is known for its potential applications in fields such as organic synthesis and medicinal chemistry, where it may exhibit antioxidant or antimicrobial properties. The compound's structure suggests it may participate in various chemical reactions, including oxidation and substitution reactions, making it of interest for further research. Additionally, its unique arrangement of functional groups may allow for interactions with biological systems, warranting investigation into its pharmacological potential. Overall, 5,8-dihydroxy-3-methyl-4-(9H)-naphtho(2,3-c)furanone represents a fascinating subject for study in both synthetic and applied chemistry contexts.

Formula: C₁₃H₁₀O₄

InChI: InChI=1/C13H10O4/c1-6-11-7(5-17-6)4-8-9(14)2-3-10(15)12(8)13(11)16/h2-3,5,14-15H,4H2,1H3

SMILES: Cc1c2c(Cc3c(ccc(c3C2=O)O)O)co1

Synonyms:

• Ms 444
• 5,8-dihydroxy-3-methylnaphtho[2,3-c]furan-4(9H)-one

Naphtho[2,3-c]furan-4(9H)-one, 5,8-dihydroxy-3-methyl-

CAS: 150045-18-4

Formula: C₁₃H₁₀O₄

Purity: 98.75%

Molecular weight: 230.2161

Ref: IN-DA001M9P

MS-444

CAS: 150045-18-4

MS-444

Purity: ≥98%

Molecular weight: 230.22g/mol

Ref: 54-BUP21875

MS-444

CAS: 150045-18-4

MS-444 is a light-chain kinase inhibitor that has been shown to be effective in the treatment of malignant glioma cells and cancer cell lines, such as HCT116. It has been shown to inhibit tumor growth and induce apoptosis in xenografts. MS-444 is localized to the nucleus and cytoplasm, and selectively inhibits the proliferation of cancer cells by binding to their surface receptors. This molecule also stabilizes the tumor microenvironment by inhibiting pro-inflammatory cytokine production.

Formula: C₁₃H₁₀O₄

Purity: Min. 95%

Molecular weight: 230.22 g/mol

Ref: 3D-AGA04518

MS-444

CAS: 150045-18-4

MS-444 (BE-34776) is an MLCK and HuR inhibitor with antitumor activity that can be used to study triple-negative breast cancer and colorectal cancer.

Formula: C₁₃H₁₀O₄

Purity: 99.45% - 99.45%

Color and Shape: Solid

Molecular weight: 230.22

Ref: TM-T16145