CAS 150058-29-0

methyl 2-ethoxy-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate

Description:

Methyl 2-ethoxy-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate, with the CAS number 150058-29-0, is a complex organic compound characterized by its unique structural features, including a benzimidazole core and a trityltetrazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the ethoxy group enhances its lipophilicity, which can influence its interaction with biological membranes. The trityltetrazole group may contribute to its pharmacological properties, potentially acting as a bioisostere for other functional groups in drug design. Additionally, the compound's molecular structure suggests it may engage in various intermolecular interactions, such as hydrogen bonding and π-π stacking, which can affect its stability and reactivity. Overall, this compound's intricate design positions it as a candidate for further investigation in medicinal chemistry and related fields.

Formula: C₄₄H₃₆N₆O₃

InChI: InChI=1/C44H36N6O3/c1-3-53-43-45-40-38(42(51)52-2)24-15-25-39(40)49(43)30-31-26-28-32(29-27-31)36-22-13-14-23-37(36)41-46-47-48-50(41)44(33-16-7-4-8-17-33,34-18-9-5-10-19-34)35-20-11-6-12-21-35/h4-29H,3,30H2,1-2H3

SMILES: CCOc1nc2c(cccc2n1Cc1ccc(cc1)c1ccccc1c1nnnn1C(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC

1H-Benzimidazole-4-carboxylic acid, 2-ethoxy-1-[[2'-[1-(triphenylmethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]-, methyl ester

CAS: 150058-29-0

Formula: C₄₄H₃₆N₆O₃

Molecular weight: 696.795

Ref: IN-DA001MAL

2-Ethoxy-1-[[2'-[1-(trityl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]-1H-benzimidazole-4-carboxylic acid methyl ester

CAS: 150058-29-0

2-Ethoxy-1-[2'-[1-(trityl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]-1H-benzimidazole-4-carboxylic acid methyl ester is an impurity in the drug product, which is a synthetic drug for research and development. The impurity standard for 2-ethoxy-1-[2'-[1-(trityl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]-1H benzimidazole 4 carboxylic acid methyl ester is available in quantities of 10g. The CAS number for the impurity is 150058-29-0. This compound has an API purity of 99.9%. Impurities are not expected to be present at greater than 1% by weight.

Formula: C₄₄H₃₆N₆O₃

Purity: Min. 95%

Molecular weight: 696.8 g/mol

Ref: 3D-IE22869