CAS 150080-09-4
:Talabostat mesylate
Description:
Talabostat mesylate, also known as PT-100, is a small molecule that functions primarily as an immunomodulator and has been investigated for its potential in cancer therapy. It acts as a potent inhibitor of the enzyme dipeptidyl peptidase IV (DPP-IV), which plays a role in immune regulation and the metabolism of various peptides. The compound is characterized by its ability to enhance immune responses, particularly by promoting the activation and proliferation of T-cells. Talabostat mesylate is typically administered in a mesylate salt form, which improves its solubility and stability. Its pharmacological profile suggests potential applications in treating various malignancies and possibly in autoimmune disorders. However, clinical studies have shown mixed results regarding its efficacy and safety, leading to ongoing research to better understand its mechanisms and optimize its therapeutic use. As with many investigational drugs, the full spectrum of its pharmacodynamics and pharmacokinetics is still being elucidated.
Formula:C10H23BN2O6S
InChI:InChI=1/C9H19BN2O3.CH4O3S/c1-6(2)8(11)9(13)12-5-3-4-7(12)10(14)15;1-5(2,3)4/h6-8,14-15H,3-5,11H2,1-2H3;1H3,(H,2,3,4)/t7-,8-;/m0./s1
SMILES:CC(C)[C@@H](C(=O)N1CCC[C@H]1B(O)O)N.CS(=O)(=O)O
Synonyms:- [(2R)-1-[(2S)-2-Amino-3-methylbutanoyl]pyrrolidin-2-yl]boronic acid mesylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
[(2R)-1-[(2S)-2-Amino-3-methylbutanoyl]pyrrolidin-2-yl]boronic acid mesylate
CAS:Formula:C10H23BN2O6SPurity:97%Color and Shape:SolidMolecular weight:310.1754Ref: IN-DA00ABLT
1gTo inquire1mg116.00€2mg123.00€5mg153.00€10mg208.00€25mg336.00€50mg250.00€100mg510.00€250mg688.00€500mgTo inquireTalabostat mesylate
CAS:<p>Talabostat mesylate (PT100): Oral DPP4 inhibitor, IC50 0.18 nM, targets tumor-linked proteins, boosts hematopoiesis.</p>Formula:C10H23BN2O6SPurity:98% - 99.91%Color and Shape:SolidMolecular weight:310.18Methanesulfonic acid ((R)-1-((S)-2-amino-3-methylbutanoyl)pyrrolidin-2-yl)boronic acid (1:1)
CAS:Formula:C10H23BN2O6SPurity:95%Molecular weight:310.17Talabostat Mesylate
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications Talabostat Mesylate can be used in biological study and pharmacological activity of treatment of cancer using immunomodulation.<br>References Mehta, V., et al.: PCT Int. Appl., WO 2017011831 A1 20170119 (2017)<br></p>Formula:C10H23BN2O6SColor and Shape:NeatMolecular weight:310.18Methanesulfonic acid ((R)-1-((S)-2-amino-3-methylbutanoyl)pyrrolidin-2-yl)boronic acid (1:1)
CAS:(R)-1-((S)-2-amino-3-methylbutanoyl)pyrrolidin-2-yl)boronic acid (1:1) is a clinical candidate for the treatment of prostate cancer and other cancers. It is an inhibitor drug that blocks the enzyme caspase 1, which is responsible for activating the inflammatory response. It has also been shown to inhibit serine proteases, which are enzymes that break down proteins in the body. Sorafenib is an inhibitor drug that blocks the enzyme dpp-iv and has been shown to be effective against metastatic colorectal cancer.Formula:C10H23BN2O6SPurity:Min. 95%Molecular weight:310.17 g/mol






