CymitQuimica logo

CAS 150164-68-4

:

2-(Acetyloxy)-N-(4-fluorophenyl)-N-(1-methylethyl)acetamide

Description:
2-(Acetyloxy)-N-(4-fluorophenyl)-N-(1-methylethyl)acetamide, with the CAS number 150164-68-4, is a chemical compound characterized by its specific functional groups and structural features. It contains an acetyloxy group, which contributes to its reactivity and solubility properties. The presence of a fluorophenyl moiety indicates potential applications in pharmaceuticals, as fluorine substitution can enhance biological activity and lipophilicity. The isopropyl group (1-methylethyl) attached to the nitrogen atom suggests steric hindrance, which may influence the compound's interaction with biological targets. This compound is likely to exhibit moderate to high polarity due to the presence of both polar acetamide and acetyloxy groups, affecting its solubility in various solvents. Additionally, the compound may participate in hydrogen bonding due to the amide functionality, which can influence its physical properties such as melting point and boiling point. Overall, this compound's unique structure positions it for potential use in medicinal chemistry and related fields.
Formula:C13H16FNO3
InChI:InChI=1/C13H16FNO3/c1-9(2)15(13(17)8-18-10(3)16)12-6-4-11(14)5-7-12/h4-7,9H,8H2,1-3H3
InChI key:InChIKey=NVGMNTIWDVRZNQ-UHFFFAOYSA-N
SMILES:N(C(COC(C)=O)=O)(C(C)C)C1=CC=C(F)C=C1
Synonyms:
  • 2-(Acetyloxy)-N-(4-fluorophenyl)-N-(1-methylethyl)acetamide
  • 2-[(4-Fluorophenyl)(isopropyl)amino]-2-oxoethyl acetate
  • acetamide, 2-(acetyloxy)-N-(4-fluorophenyl)-N-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.