CymitQuimica logo

CAS 15018-03-8

:

Methyl 3,5-Di-tert-butylsalicylate

Description:
Methyl 3,5-Di-tert-butylsalicylate is an organic compound characterized by its ester functional group, derived from salicylic acid and tert-butyl groups. It features a methyl ester at the carboxylic acid end and two bulky tert-butyl groups at the 3 and 5 positions of the aromatic ring, which contribute to its steric hindrance and lipophilicity. This compound is typically a colorless to pale yellow liquid with a pleasant odor, making it useful in fragrance applications. It exhibits moderate solubility in organic solvents and limited solubility in water due to its hydrophobic tert-butyl groups. Methyl 3,5-Di-tert-butylsalicylate is known for its UV-absorbing properties, which makes it valuable in cosmetic formulations as a UV filter. Additionally, it may possess antioxidant properties, contributing to its potential applications in various industries, including cosmetics and pharmaceuticals. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C16H24O3
InChI:InChI=1/C16H24O3/c1-15(2,3)10-8-11(14(18)19-7)13(17)12(9-10)16(4,5)6/h8-9,17H,1-7H3
InChI key:QSGONIQEKLJPGV-UHFFFAOYSA-N
SMILES:CC(C)(C)c1cc(c(c(c1)C(C)(C)C)O)C(=O)OC
Synonyms:
  • Methyl 3,5-di-t-butylsalicylate
  • Methyl 3,5-Di-Tert-Butyl-2-Hydroxybenzoate
Found 3 products.