CAS 15018-56-1
:5-Bromo-6-methyl-2,4(1H,3H)-pyrimidinedione
Description:
5-Bromo-6-methyl-2,4(1H,3H)-pyrimidinedione, with the CAS number 15018-56-1, is a heterocyclic organic compound belonging to the pyrimidine family. This compound features a pyrimidinedione core, which is characterized by a six-membered ring containing two nitrogen atoms and two carbonyl groups. The presence of a bromine atom at the 5-position and a methyl group at the 6-position contributes to its unique chemical properties. It is typically a crystalline solid and is soluble in polar organic solvents. The compound exhibits potential biological activity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial and anticancer agents. Its reactivity can be attributed to the electron-withdrawing nature of the bromine and carbonyl groups, which can influence its interactions in various chemical reactions. Additionally, the compound's structure allows for potential derivatization, which can enhance its biological activity or alter its physicochemical properties for specific applications.
Formula:C5H5BrN2O2
InChI:InChI=1S/C5H5BrN2O2/c1-2-3(6)4(9)8-5(10)7-2/h1H3,(H2,7,8,9,10)
InChI key:InChIKey=HEAXNUZNYDEXFG-UHFFFAOYSA-N
SMILES:BrC1=C(C)NC(=O)NC1=O
Synonyms:- 2,4(1H,3H)-Pyrimidinedione, 5-bromo-6-methyl-
- 5-Bromo-6-methyl-2,4(1H,3H)-pyrimidinedione
- 5-Bromo-6-methylpyrimidine-2,4-diol
- 5-bromo-6-methylpyrimidine-2,4(1H,3H)-dione
- Ai3-26570
- NSC 53064
- Uracil, 5-bromo-6-methyl-
- 5-Bromo-6-methyluracil
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4(1H,3H)-Pyrimidinedione, 5-bromo-6-methyl-
CAS:Formula:C5H5BrN2O2Purity:95%Color and Shape:SolidMolecular weight:205.00945-Bromo-6-Methylpyrimidine-2,4-Diol
CAS:5-Bromo-6-Methylpyrimidine-2,4-DiolPurity:97%Molecular weight:205.01g/mol5-Bromo-6-methylpyrimidine-2,4-diol
CAS:Formula:C5H5BrN2O2Purity:95%Color and Shape:Solid, No data available.Molecular weight:205.0115-Bromo-6-methylpyrimidine-2,4(1H,3H)-dione
CAS:5-Bromo-6-methylpyrimidine-2,4(1H,3H)-dione is an immunosuppressive drug that belongs to the class of hydantoins. It can be used to treat a variety of diseases associated with immunodeficiency including AIDS. 5-Bromo-6-methylpyrimidine-2,4(1H,3H)-dione inhibits viral replication by alkylating nucleotides and DNA synthesis at the GTPase level. The amide group in the molecule is responsible for this property. Kinetics studies have shown that the rate of hydrolysis of 5-bromo-6-methylpyrimidine-2,4(1H,3H)-dione depends on the pH and temperature of solution.
Formula:C5H5BrN2O2Purity:Min. 95%Molecular weight:205.01 g/mol



