CAS 150256-42-1
:N-fmoc-anthranilic acid
Description:
N-Fmoc-anthranilic acid is a chemical compound characterized by the presence of a fluorene-9-methoxycarbonyl (Fmoc) protecting group attached to the amino group of anthranilic acid. This compound is typically used in peptide synthesis as a protective group for the amino functionality, allowing for selective reactions without interfering with other functional groups. N-Fmoc-anthranilic acid is a white to off-white solid, soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF), but generally insoluble in water. Its structure features an anthranilic acid backbone, which includes an amino group and a carboxylic acid group, contributing to its reactivity and utility in organic synthesis. The Fmoc group is known for its stability under basic conditions and can be removed under mild acidic conditions, making it a popular choice in solid-phase peptide synthesis. Overall, N-Fmoc-anthranilic acid serves as a versatile intermediate in the preparation of various bioactive compounds and peptides.
Formula:C22H16NO4
InChI:InChI=1/C22H17NO4/c24-21(25)18-11-5-6-12-20(18)23-22(26)27-13-19-16-9-3-1-7-14(16)15-8-2-4-10-17(15)19/h1-12,19H,13H2,(H,23,26)(H,24,25)/p-1
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=Nc1ccccc1C(=O)[O-])O
Synonyms:- Fmoc-2-Abz-OH
- Fmoc-2-aminobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]benzoic Acid
CAS:Formula:C22H17NO4Purity:>96.0%(T)(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:359.382-(Fmoc-amino)benzoic acid, 98%
CAS:It is a important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa
Formula:C22H16NO4Purity:98%Molecular weight:358.37Fmoc-2-Abz-OH
CAS:M06085 - Fmoc-2-Abz-OH
Formula:C22H17NO4Purity:96%Color and Shape:SolidMolecular weight:359.381Fmoc-Abz-OH
CAS:Bachem ID: 4028486.
Formula:C22H17NO4Purity:99.29%Color and Shape:White PowderMolecular weight:359.38Benzoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-
CAS:Formula:C22H17NO4Purity:95%Color and Shape:SolidMolecular weight:359.3747






