CAS 150283-04-8
:N-{(2R,6S,9R,11R,12R,14aS,15S,20S,23S,25aS)-20-[(1S)-3-amino-1-hydroxypropyl]-23-[(1S,2S)-1,2-dihydroxy-2-(4-hydroxyphenyl)ethyl]-2,11,12,15-tetrahydroxy-6-[(1S)-1-hydroxyethyl]-5,8,14,19,22,25-hexaoxotetracosahydro-1H-dipyrrolo[2,1-c:2',1'-l][1,4,7,10,13
Description:
The chemical substance with the name provided is a complex organic molecule characterized by a multi-ring structure and numerous functional groups, including multiple hydroxyl (-OH) and amino (-NH2) groups. This compound is part of a class of molecules known for their potential biological activity, often exhibiting properties such as antimicrobial or anticancer effects. The stereochemistry indicated by the (R) and (S) designations suggests that the molecule has several chiral centers, which can significantly influence its biological interactions and pharmacological properties. The presence of multiple hydroxyl groups enhances its solubility in water and may contribute to its reactivity and ability to form hydrogen bonds. Additionally, the intricate arrangement of its rings and substituents suggests that it may engage in specific interactions with biological targets, making it of interest in medicinal chemistry. Overall, this substance exemplifies the complexity and diversity of organic compounds, particularly those with potential therapeutic applications.
Formula:C50H82N8O16
InChI:InChI=1/C50H82N8O16/c1-5-26(2)22-27(3)12-10-8-6-7-9-11-13-37(65)52-32-24-36(64)46(70)56-48(72)41-35(63)19-21-57(41)50(74)39(34(62)18-20-51)54-47(71)40(43(67)42(66)29-14-16-30(60)17-15-29)55-45(69)33-23-31(61)25-58(33)49(73)38(28(4)59)53-44(32)68/h14-17,26-28,31-36,38-43,46,59-64,66-67,70H,5-13,18-25,51H2,1-4H3,(H,52,65)(H,53,68)(H,54,71)(H,55,69)(H,56,72)/t26?,27?,28-,31+,32+,33-,34-,35-,36+,38-,39-,40-,41-,42-,43-,46+/m0/s1
Synonyms:- Caspofungin Impurity 1 (5-((3R)-3-Hydroxy-L-Ornithine)-Pneumocandin B0)
- Pneumocandin B0,5-[(3R)-3-hydroxy-L-ornithine]-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Caspofungin Impurity 1 Trifluoroacetate (5-((3R)-3-Hydroxy-L-Ornithine)-Pneumocandin B0 Trifluoroacetate)
CAS:Formula:C50H82N8O16·C2HF3O2Molecular weight:1051.25 114.02

