CymitQuimica logo

CAS 15029-26-2

:

2-CYANO-N-(2-MORPHOLIN-4-YL-ETHYL)-ACETAMIDE

Description:
2-Cyano-N-(2-morpholin-4-yl-ethyl)-acetamide, with the CAS number 15029-26-2, is a chemical compound characterized by its unique functional groups, including a cyano group and an acetamide moiety. This compound features a morpholine ring, which contributes to its potential biological activity and solubility properties. Typically, compounds of this nature are studied for their pharmacological applications, particularly in medicinal chemistry, due to their ability to interact with biological targets. The presence of the cyano group may enhance its reactivity and influence its interaction with enzymes or receptors. Additionally, the morpholine structure can provide flexibility and steric effects that are crucial for binding affinity. The compound is likely to be a solid at room temperature and may exhibit moderate to high polarity, affecting its solubility in various solvents. Safety data should be consulted for handling and potential toxicity, as with any chemical substance, especially those with biological activity. Overall, 2-cyano-N-(2-morpholin-4-yl-ethyl)-acetamide represents a class of compounds with significant interest in chemical and pharmaceutical research.
Formula:C9H15N3O2
InChI:InChI=1/C9H15N3O2/c10-2-1-9(13)11-3-4-12-5-7-14-8-6-12/h1,3-8H2,(H,11,13)
SMILES:C(C#N)C(=NCCN1CCOCC1)O
Synonyms:
  • 4-{2-[(Cyanoacetyl)Amino]Ethyl}Morpholin-4-Ium
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.