CymitQuimica logo

CAS 1503-60-2

:

1-chloro-4-[(E)-2-(4-methoxyphenyl)-2-phenylethenyl]benzene

Description:
1-Chloro-4-[(E)-2-(4-methoxyphenyl)-2-phenylethenyl]benzene, with the CAS number 1503-60-2, is an organic compound characterized by its aromatic structure and the presence of both chlorine and methoxy functional groups. This compound features a chlorobenzene moiety substituted at the para position with a styryl group, which is further substituted with a methoxyphenyl group. The presence of the E configuration indicates a specific geometric arrangement around the double bond in the styryl group, which can influence its reactivity and interactions. The compound is likely to exhibit properties typical of aromatic compounds, such as stability and potential for electrophilic substitution reactions. Additionally, the methoxy group can enhance solubility in organic solvents and may also influence the compound's electronic properties, making it of interest in various chemical applications, including organic synthesis and materials science. Its unique structure may also confer specific biological activities, warranting further investigation in pharmacological contexts.
Formula:C21H17ClO
InChI:InChI=1/C21H17ClO/c1-23-20-13-9-18(10-14-20)21(17-5-3-2-4-6-17)15-16-7-11-19(22)12-8-16/h2-15H,1H3/b21-15+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.