CAS 150314-35-5
:N-(2-Hydroxyethyl)-7Z,10Z,13Z,16Z-docosatetraenamide
Description:
N-(2-Hydroxyethyl)-7Z,10Z,13Z,16Z-docosatetraenamide, commonly referred to as a type of fatty acid amide, is a compound characterized by its long hydrocarbon chain and multiple double bonds, specifically in the Z configuration. This structure contributes to its unique physical and chemical properties, such as increased fluidity and potential biological activity. The presence of the hydroxyethyl group enhances its solubility in polar solvents, making it more versatile in various applications. This compound is of interest in biochemical research, particularly in studies related to lipid metabolism and signaling pathways. Its amide functional group may also suggest potential interactions with biological membranes and proteins. Additionally, the specific configuration of the double bonds can influence its reactivity and stability, which are critical factors in its potential use in pharmaceuticals or as a biochemical probe. Overall, N-(2-Hydroxyethyl)-7Z,10Z,13Z,16Z-docosatetraenamide represents a fascinating subject for further investigation in both synthetic and biological chemistry.
Formula:C24H41NO2
InChI:InChI=1S/C24H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(27)25-22-23-26/h6-7,9-10,12-13,15-16,26H,2-5,8,11,14,17-23H2,1H3,(H,25,27)/b7-6-,10-9-,13-12-,16-15-
InChI key:InChIKey=FMVHVRYFQIXOAF-DOFZRALJSA-N
SMILES:C(CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC)CC(NCCO)=O
Synonyms:- (7Z,10Z,13Z,16Z)-N-(2-Hydroxyethyl)-7,10,13,16-docosatetraenamide
- (all-Z)-N-(7,10,13,16-Docosatetraenoyl)ethanolamine
- 7,10,13,16-Docosatetraenamide, N-(2-hydroxyethyl)-, (7Z,10Z,13Z,16Z)-
- 7,10,13,16-Docosatetraenamide, N-(2-hydroxyethyl)-, (all-Z)-
- Docosatetraenoyl Ethanolamide
- Docosatetraenylethanolamide
- N-(2-Hydroxyethyl)-7Z, 10Z, 13Z, 16Z-Docosatetraenamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Docosatetraenoyl Ethanolamide-d4
CAS:Controlled ProductApplications Docosatetraenoyl Ethanolamide-d4 is the labelled analogue of (7Z,10Z,13Z,16Z)-N-(2-Hydroxyethyl)-7,10,13,16-docosatetraenamide (H943240), which is an endocannabinoid and an analog of anandamide, which is an endogenous cannabinoid and TRPV1 receptor agonist.
References Donovan, J. and Grundy D. Neurogastroenterol Motil. 23, 567 (2011); Walter, L., et al.: J. Biol. Chem. 277, 20869 (2002)Formula:C24D4H37NO2Color and Shape:NeatMolecular weight:379.613(7Z,10Z,13Z,16Z)-N-(2-Hydroxyethyl)-7,10,13,16-docosatetraenamide
CAS:Controlled ProductFormula:C24H41NO2Color and Shape:NeatMolecular weight:375.5887,10,13,16-Docosatetraenamide, N-(2-hydroxyethyl)-, (7Z,10Z,13Z,16Z)-
CAS:Formula:C24H41NO2Molecular weight:375.5878

