CAS 150379-37-6
:N-(2,3-dichlorophenyl)-2-hydroxy-4-oxo-1,5-dioxaspiro[5.5]undec-2-ene-3-carboxamide
Description:
N-(2,3-dichlorophenyl)-2-hydroxy-4-oxo-1,5-dioxaspiro[5.5]undec-2-ene-3-carboxamide, with the CAS number 150379-37-6, is a synthetic organic compound characterized by its complex spirocyclic structure. This compound features a dioxaspiro framework, which contributes to its unique three-dimensional conformation, potentially influencing its biological activity. The presence of a dichlorophenyl group suggests that it may exhibit significant hydrophobic interactions, while the hydroxyl and carboxamide functional groups can engage in hydrogen bonding, enhancing its solubility in polar solvents. The keto group within the structure may also play a role in reactivity and stability. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, which may include antimicrobial or anti-inflammatory activities. Its specific interactions with biological targets would depend on its conformational flexibility and the electronic effects imparted by the substituents. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.
Formula:C16H15Cl2NO5
InChI:InChI=1/C16H15Cl2NO5/c17-9-5-4-6-10(12(9)18)19-13(20)11-14(21)23-16(24-15(11)22)7-2-1-3-8-16/h4-6,21H,1-3,7-8H2,(H,19,20)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cgp 43182
CAS:CGP 43182 inhibits Group IIA sPLA2, blocking cytokine-induced NFkappaB pro-inflammatory gene synergy.Formula:C16H15Cl2NO5Color and Shape:SolidMolecular weight:372.2
