CAS 1504-06-9: 3-Methyloxindole
Description:3-Methyloxindole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. It features a methyl group attached to the carbon at the 3-position of the oxindole moiety. This compound is typically a white to off-white solid and is known for its moderate solubility in organic solvents. 3-Methyloxindole is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial and anticancer properties. Its molecular formula is C9H9NO, and it has a molecular weight that reflects its composition of carbon, hydrogen, nitrogen, and oxygen. The compound can undergo various chemical reactions, including oxidation and substitution, making it a versatile intermediate in organic synthesis. Additionally, it may participate in the formation of more complex molecules, contributing to its relevance in research and pharmaceutical applications. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H9NO
InChI:InChI=1S/C9H9NO/c1-6-7-4-2-3-5-8(7)10-9(6)11/h2-6H,1H3,(H,10,11)
InChI key:InChIKey=BBZCPUCZKLTAJQ-UHFFFAOYSA-N
SMILES:O=C1NC=2C=CC=CC2C1C
- Synonyms:
- (R,S)-3-Methyl-1,3-dihydro-indol-2-one
- 1,3-Dihydro-3-methyl-2H-indol-2-one
- 2-Indolinone, 3-methyl-
- 2H-Indol-2-one, 1,3-dihydro-3-methyl-
- 3-Methyl-1,3-dihydro-indol-2-one
- 3-Methyl-1,3-dihydroindol-2-one
- 3-Methyl-2,3-dihydro-1H-indol-2-one
- 3-Methyl-2-indolinone
- 3-Methyl-2-oxindole
- 3-Methyloxindole
- See more synonyms
- 3-Methyloxyindole
- 3-methyl-1,3-dihydro-2H-indol-2-one
- Oxindole, 3-methyl-
- 3-METHYLOXINDOLE 96%
