CAS 1504-76-3
:3-(3-Nitrophenyl)-2-propenal
Description:
3-(3-Nitrophenyl)-2-propenal, also known as 3-nitrocinnamaldehyde, is an organic compound characterized by its structure, which features a propenal moiety with a nitrophenyl substituent. This compound typically appears as a yellow to orange crystalline solid and is known for its aromatic properties due to the presence of the nitrophenyl group. It has a significant dipole moment owing to the electron-withdrawing nitro group, which influences its reactivity and solubility in various solvents. The compound is often utilized in organic synthesis and can serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its reactivity is attributed to the conjugated system present in the molecule, making it susceptible to electrophilic aromatic substitution and other chemical transformations. Additionally, 3-(3-Nitrophenyl)-2-propenal exhibits potential biological activity, which has been the subject of research in medicinal chemistry. Safety precautions should be observed when handling this compound due to its potential toxicity and environmental impact.
Formula:C9H7NO3
InChI:InChI=1S/C9H7NO3/c11-6-2-4-8-3-1-5-9(7-8)10(12)13/h1-7H
InChI key:InChIKey=JKTVNBZTQKQRSH-UHFFFAOYSA-N
SMILES:C(=CC=O)C1=CC(N(=O)=O)=CC=C1
Synonyms:- (2E)-3-(3-Nitrophenyl)acrylaldehyde
- 2-Propenal, 3-(3-nitrophenyl)-
- 2-propenal, 3-(3-nitrophenyl)-, (2E)-
- 3-(3-Nitrophenyl)-2-propenal
- 3-(3-Nitrophenyl)prop-2-enal
- 3-Nitrocinnamaldehyde
- 3-Nitrocinnamic aldehyde
- Cinnamaldehyde, m-nitro-
- NSC 104462
- m-Nitrocinnamaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(3-Nitrophenyl)-2-propenal
CAS:Controlled Product<p>Applications 3-(3-Nitrophenyl)-2-propenal is an intermediate for the synthesis of Methyl 4-Hydroxy-4-methyl-2-(3-nitrophenyl)-6-oxocyclohexanecarboxylate (M493175), which is an impurity of Nicardipine (N394500).<br></p>Formula:C9H7NO3Color and Shape:NeatMolecular weight:177.157
