CAS 150403-89-7
:L-N6-(1-IMINOETHYL)LYSINE DIHYDROCHLORIDE
Description:
L-N6-(1-Iminoethyl)lysine dihydrochloride, with the CAS number 150403-89-7, is a synthetic amino acid derivative that serves as a potent inhibitor of nitric oxide synthase (NOS). This compound is characterized by its structural modification of the amino acid lysine, specifically at the N6 position, where an iminoethyl group is introduced. It is typically encountered as a dihydrochloride salt, which enhances its solubility in aqueous solutions, making it suitable for biological studies. The compound is often utilized in research to investigate the role of nitric oxide in various physiological and pathological processes, including cardiovascular function and immune response. Its ability to inhibit NOS makes it valuable in studying conditions where nitric oxide plays a critical role, such as inflammation and neurodegenerative diseases. Additionally, L-N6-(1-iminoethyl)lysine dihydrochloride is known for its relatively low toxicity, which allows for its use in various experimental settings without significant adverse effects on cellular viability.
Formula:C8H18N3O2
InChI:InChI=1/C8H17N3O2/c1-6(9)11-5-3-2-4-7(10)8(12)13/h7H,2-5,10H2,1H3,(H2,9,11)(H,12,13)/p+1/t7-/m0/s1
Synonyms:- L-N6-(1-Iminoethyl)-Lysine (Acetate Salt)
- L-N6-(1-Iminoethyl) Lysine, Hydrochloride
- L-Nil
- (E)-N~6~-(1-aminoethylidene)-L-lysine dihydrochloride
- (2S)-6-{[(1E)-1-aminoethylidene]ammonio}-2-ammoniohexanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N6-(1-Iminoethyl)-L-lysine hydrochloride
CAS:<p>N6-(1-Iminoethyl)-L-lysine hydrochloride is an experimental drug that inhibits bacterial translocation, a process which occurs when bacteria from the gastrointestinal tract invade organs and tissues in the body that are not protected by a mucous barrier. It has been shown to be effective in reducing chronic pulmonary inflammation and fibrosis, as well as inhibiting emphysema-like lesions, in mice. N6-(1-Iminoethyl)-L-lysine hydrochloride also has anti-inflammatory effects on the skin and reduces the production of proinflammatory cytokines such as PGE2.</p>Formula:C8H18ClN3O2Purity:Min. 95%Molecular weight:223.7 g/molL-NIL hydrochloride
CAS:selective inhibitor of inducible nitric oxide synthaseFormula:C8H18ClN3O2Purity:98%Color and Shape:White To Off-White SolidMolecular weight:223.7


