CymitQuimica logo

CAS 15043-17-1

:

Dodecahydro-6-hydroxy-7,14-methano-2H,11H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-11-one

Description:
Dodecahydro-6-hydroxy-7,14-methano-2H,11H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-11-one, with CAS number 15043-17-1, is a complex organic compound characterized by its unique bicyclic structure that incorporates nitrogen atoms within its rings. This compound features multiple fused rings, which contribute to its rigidity and potential biological activity. The presence of hydroxyl (-OH) groups indicates that it may exhibit polar characteristics, influencing its solubility in various solvents. The methano bridge in its structure suggests potential for interesting stereochemistry and reactivity. Such compounds often have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their structural complexity and potential interactions with biological targets. Additionally, the presence of nitrogen in the ring system may enhance its ability to form hydrogen bonds, further affecting its chemical behavior and interactions. Overall, this compound exemplifies the intricate nature of heterocyclic chemistry and its relevance in various scientific fields.
Formula:C15H24N2O2
InChI:InChI=1S/C15H24N2O2/c18-14-6-3-5-13-11-8-10(9-17(13)14)12-4-1-2-7-16(12)15(11)19/h10-13,15,19H,1-9H2
InChI key:InChIKey=LCORZQTZVFOPGT-UHFFFAOYSA-N
SMILES:OC1C2C3N(CC(C2)C4N1CCCC4)C(=O)CCC3
Synonyms:
  • 2-Oxo-17-hydroxysparteine
  • 7,14-Methano-2H,11H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-11-one, dodecahydro-6-hydroxy-
  • Dodecahydro-6-hydroxy-7,14-methano-2H,11H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-11-one
  • 17-Hydroxylupanine
  • Lupanine, 17-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.