
CAS 15049-85-1
:AEDP
Description:
AEDP, or 2-Amino-2-(ethylamino)propane-1,3-diol, is a chemical compound characterized by its amino alcohol structure. It typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. AEDP is known for its solubility in water and various organic solvents, which makes it versatile in chemical applications. The presence of amino and hydroxyl functional groups contributes to its reactivity, allowing it to participate in various chemical reactions, including those involving nucleophilic substitution and condensation. AEDP is often utilized in the synthesis of pharmaceuticals, agrochemicals, and as a building block in organic chemistry. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific formulation. Safety data indicates that, like many amines, AEDP should be handled with care due to potential irritant effects on skin and eyes, and appropriate safety measures should be taken during its use in laboratory or industrial settings.
Formula:C2H9NO6P2
InChI:InChI=1S/C2H9NO6P2/c1-2(3,10(4,5)6)11(7,8)9/h3H2,1H3,(H2,4,5,6)(H2,7,8,9)
InChI key:InChIKey=GPCTYPSWRBUGFH-UHFFFAOYSA-N
SMILES:C(P(=O)(O)O)(P(=O)(O)O)(C)N
Synonyms:- Phosphonic acid, (1-aminoethylidene)di-
- Phosphonic acid, (1-aminoethylidene)bis-
- P,P′-(1-Aminoethylidene)bis[phosphonic acid]
- α-Aminoethane-α,α-diphosphonic acid
- Phosphonic acid, P,P′-(1-aminoethylidene)bis-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(1-Aminoethane-1,1-diyl)diphosphonic acid
CAS:(1-Aminoethane-1,1-diyl)diphosphonic acid (HEDPA) is a synthetic phosphonate that is soluble in water and organic solvents. HEDPA has been used in gravimetric analysis because it is stable to boiling point and can be easily dried on the surface of a glass plate. It also has been used as a reagent for the synthesis of hydroxy methyl phosphonates and other phosphonate compounds. In crystal x-ray diffraction, HEDPA shows strong hydrogen bonding interactions with counterions such as PO43-, SO42-, or NH4+. The coordination chemistry of HEDPA involves metal ions such as Fe3+, Cu2+, Co2+, Ni2+, Cr3+, Mn2+, Zn2+, Cd2+ and Al3+. Functional theory predicts that the architecture of HEDPA's supramolecular units are either tetrahedral or octahedral. InfFormula:C2H9NO6P2Purity:Min. 95%Color and Shape:PowderMolecular weight:205.04 g/mol
