CymitQuimica logo

CAS 1505-38-0

:

3-(2-ethyl-1-methyl-3-propylpyrrolidin-3-yl)phenol

Description:
3-(2-ethyl-1-methyl-3-propylpyrrolidin-3-yl)phenol, with the CAS number 1505-38-0, is a chemical compound that features a phenolic structure substituted with a pyrrolidine moiety. This compound is characterized by its complex molecular structure, which includes a phenol group attached to a pyrrolidine ring that is further substituted with ethyl and propyl groups. The presence of these alkyl substituents contributes to its hydrophobic properties, potentially influencing its solubility in organic solvents. The compound may exhibit biological activity, which could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific interactions and reactivity can vary based on the functional groups present, making it a candidate for various applications in chemical synthesis and drug development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C16H25NO
InChI:InChI=1/C16H25NO/c1-4-9-16(10-11-17(3)15(16)5-2)13-7-6-8-14(18)12-13/h6-8,12,15,18H,4-5,9-11H2,1-3H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.