CymitQuimica logo

CAS 150514-78-6

:

3-Pyridinemethanaminium, 5,6-bis(methoxycarbonyl)-N,N,N-trimethyl-, bromide (1:1)

Description:
3-Pyridinemethanaminium, 5,6-bis(methoxycarbonyl)-N,N,N-trimethyl-, bromide (1:1), with CAS number 150514-78-6, is a quaternary ammonium compound characterized by its pyridine ring structure and multiple methoxycarbonyl substituents. This compound typically exhibits a cationic nature due to the presence of the trimethylammonium group, which contributes to its solubility in polar solvents. The bromide ion serves as the counterion, enhancing the compound's stability and ionic character. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and materials science, particularly due to its ability to interact with biological membranes and its potential as a surfactant. The presence of methoxycarbonyl groups may also impart specific reactivity and functional properties, making it a candidate for further chemical modifications. Overall, this compound's unique structural features and ionic properties make it of interest for research and industrial applications.
Formula:C13H19N2O4·Br
InChI:InChI=1S/C13H19N2O4.BrH/c1-15(2,3)8-9-6-10(12(16)18-4)11(14-7-9)13(17)19-5;/h6-7H,8H2,1-5H3;1H/q+1;/p-1
InChI key:InChIKey=HPXLXXVNESZDSQ-UHFFFAOYSA-M
SMILES:C(OC)(=O)C1=C(C(OC)=O)N=CC(C[N+](C)(C)C)=C1.[Br-]
Synonyms:
  • Dimethyl 5-[(trimethylammonio)methyl]pyridine-2,3-dicarboxylate bromide
  • 3-Pyridinemethanaminium, 5,6-bis(methoxycarbonyl)-N,N,N-trimethyl-, bromide
  • [[5,6-Bis(methoxycarbonyl)-3-pyridyl]methyl]trimethylammonium bromide
  • 3-Pyridinemethanaminium, 5,6-bis(methoxycarbonyl)-N,N,N-trimethyl-, bromide (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.