CAS 150529-73-0
:Methyl 2-(3-bromophenyl)acetate
Description:
Methyl 2-(3-bromophenyl)acetate is an organic compound characterized by its ester functional group, which is derived from the reaction of acetic acid and 3-bromophenol. It features a methyl ester group attached to a phenyl ring that has a bromine substituent at the meta position. This compound typically appears as a colorless to pale yellow liquid with a sweet, fruity odor. It is moderately soluble in organic solvents like ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the bromine atom introduces notable reactivity, making it useful in various chemical synthesis applications, particularly in the field of medicinal chemistry and organic synthesis. Methyl 2-(3-bromophenyl)acetate can undergo nucleophilic substitution reactions and can serve as an intermediate in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.
Formula:C9H9BrO2
InChI:InChI=1S/C9H9BrO2/c1-12-9(11)6-7-3-2-4-8(10)5-7/h2-5H,6H2,1H3
InChI key:InChIKey=ULSSGHADTSRELG-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C1=CC(Br)=CC=C1
Synonyms:- Benzeneacetic acid, 3-bromo-, methyl ester
- Methyl 2-(3-Bromophenyl)Acetate
- Methyl 3-bromobenzeneacetate
- Methyl 3-bromophenylacetate
- Methyl 3-bromophenylacetate 98%
- Methyl m-bromophenylacetate
- (3-Bromophenyl)acetic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 3-Bromophenylacetate
CAS:Formula:C9H9BrO2Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:229.07Benzeneacetic acid, 3-bromo-, methyl ester
CAS:Formula:C9H9BrO2Purity:95%Color and Shape:LiquidMolecular weight:229.0706Methyl 3-bromophenylacetate
CAS:Methyl 3-bromophenylacetateFormula:C9H9BrO2Purity:98%Color and Shape: clear. colourless liquidMolecular weight:229.07g/molMethyl 2-(3-bromophenyl)acetate
CAS:Formula:C9H9BrO2Purity:95%Color and Shape:Liquid, ClearMolecular weight:229.073Methyl 2-(3-bromophenyl)acetate
CAS:Methyl 2-(3-bromophenyl)acetate is a cross-coupling reaction that is catalyzed by palladium, nickel, or copper. It is used to synthesize biphenyl with a stepwise reaction. Methyl 2-(3-bromophenyl)acetate is also an organic solvent and can be used in the synthesis of some lipases. The cross-coupling reaction can be carried out using various solvents depending on the reactants, but it generally requires an organic solvent. This type of reaction is reproducible and yields high yields. It is a biomimetic strategy that rationalizes the mechanism of biological reactions and has a wide range of applications in organic synthesis.Formula:C9H9BrO2Purity:Min. 95%Molecular weight:229.07 g/mol




