CAS 150536-99-5

2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfanyl]aniline

Description:

2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfanyl]aniline, with the CAS number 150536-99-5, is an organic compound characterized by the presence of both an aniline group and a pyrazole moiety. This compound features a sulfanyl (thio) group that connects the pyrazole ring to the aniline structure, which can influence its reactivity and solubility. The presence of the dimethyl groups on the pyrazole ring enhances its lipophilicity and may affect its biological activity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific arrangement of functional groups can lead to interesting electronic properties and reactivity patterns, making it a subject of interest in medicinal chemistry. Additionally, the compound may exhibit various physical properties such as melting point, boiling point, and solubility, which are essential for understanding its behavior in different environments. Safety data and handling precautions should be considered when working with this substance, as with any chemical compound.

Formula: C₁₁H₁₃N₃S

InChI: InChI=1/C11H13N3S/c1-7-11(8(2)14-13-7)15-10-6-4-3-5-9(10)12/h3-6H,12H2,1-2H3,(H,13,14)

SMILES: Cc1c(c(C)n[nH]1)Sc1ccccc1N

Synonyms:

• benzenamine, 2-[(3,5-dimethyl-1H-pyrazol-4-yl)thio]-

2-((3,5-Dimethyl-1H-pyrazol-4-yl)thio)aniline

CAS: 150536-99-5

Formula: C₁₁H₁₃N₃S

Molecular weight: 219.3060

Ref: IN-DA001MPK

2-[(3,5-dimethyl-1H-pyrazol-4-yl)thio]aniline

CAS: 150536-99-5

Formula: C₁₁H₁₃N₃S

Purity: 95.0%

Molecular weight: 219.31

Ref: 10-F313948