CAS 15054-86-1
:1,2-Ethane-1,1,2,2-d4-diol-d2
Description:
1,2-Ethane-1,1,2,2-d4-diol-d2, also known by its CAS number 15054-86-1, is a deuterated form of ethylene glycol, which is a simple diol with two hydroxyl (-OH) groups. This compound features a molecular structure where the hydrogen atoms are replaced by deuterium, a stable isotope of hydrogen, enhancing its utility in various scientific applications, particularly in NMR spectroscopy and other analytical techniques. The presence of deuterium allows for improved resolution and sensitivity in studies involving molecular dynamics and interactions. As a diol, it exhibits characteristics typical of alcohols, such as being hygroscopic and having a relatively high boiling point compared to hydrocarbons of similar molecular weight. Its chemical behavior is similar to that of ethylene glycol, making it useful in applications such as antifreeze formulations, solvents, and in the synthesis of other chemical compounds. However, due to its isotopic labeling, it is primarily utilized in research settings rather than in large-scale industrial applications.
Formula:C2D6O2
InChI:InChI=1S/C2H6O2/c3-1-2-4/h3-4H,1-2H2/i1D2,2D2,3D,4D
InChI key:InChIKey=LYCAIKOWRPUZTN-UFSLNRCZSA-N
SMILES:C(C(O[2H])([2H])[2H])(O[2H])([2H])[2H]
Synonyms:- (~2~H_4_)ethane-1,2-(~2~H_2_)diol
- 1,1,2,2-Tetradeuterio-1,2-dideuteriooxyethane
- 1,2-Ethane-1,1,2,2-d<sub>4</sub>-diol-d<sub>2</sub>
- Ethane-1,2-Diol
- Ethylene-d<sub>4</sub> glycol-d<sub>2</sub>
- Ethyleneglycol-d<sub>6</sub>
- Ethylene-d4 glycol-d2
- 1,2-Ethane-1,1,2,2-d4-diol-d2
- Ethyleneglycol-d6
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethylene glycol-d{6}, 98% (Isotopic)
CAS:<p>It is used in synthetic materials and chemical research. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has n</p>Formula:C2H6O2Purity:98%Color and Shape:Clear colorless, LiquidMolecular weight:68.11Ethylene Glycol-d6
CAS:Formula:DOCD2CD2ODPurity:98 atom % DColor and Shape:Colorless. Viscous Liquid.Molecular weight:68.07444Ethylene Glycol-d6
CAS:Controlled Product<p>Applications Ethylene Glycol-D6 (D, 98%) (cas# 15054-86-1) is a useful research chemical.<br></p>Formula:C2D6O2Color and Shape:NeatMolecular weight:68.11,2-Ethane-1,1,2,2-d4-diol-d2 (9CI)
CAS:Formula:C2D6O2Purity:97%Color and Shape:LiquidMolecular weight:68.1048Ref: IN-DA001MPR
Discontinued product




