CAS 15058-19-2
:4-Thiazolecarboxylic acid, 4,5-dihydro-2-methyl-, sodium salt (1:1)
Description:
4-Thiazolecarboxylic acid, 4,5-dihydro-2-methyl-, sodium salt (1:1), with CAS number 15058-19-2, is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic compound containing sulfur and nitrogen. This substance typically appears as a white to off-white solid and is soluble in water due to the presence of the sodium salt form, which enhances its ionic character. The compound exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and neutralization. It is often utilized in biochemical applications, potentially serving as a building block in organic synthesis or as a reagent in pharmaceutical research. Additionally, the thiazole moiety is known for its biological activity, making this compound of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H7NO2S·Na
InChI:InChI=1S/C5H7NO2S.Na/c1-3-6-4(2-9-3)5(7)8;/h4H,2H2,1H3,(H,7,8);
InChI key:InChIKey=GGAXMXUOAMKGNY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1N=C(C)SC1.[Na]
Synonyms:- 2-Thiazoline-4-carboxylic acid, 2-methyl-, sodium salt
- 4-Thiazolecarboxylic acid, 4,5-dihydro-2-methyl-, sodium salt
- 4-Thiazolecarboxylic acid, 4,5-dihydro-2-methyl-, sodium salt (1:1)
- Sodium 2-Methyl-4,5-Dihydro-1,3-Thiazole-4-Carboxylate
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Sodium 2-Methyl-4,5-Dihydrothiazole-4-Carboxylate
CAS:Sodium 2-Methyl-4,5-Dihydrothiazole-4-CarboxylateFormula:C5H6NNaO2SPurity:97%Molecular weight:167.162-METHYL-2-THIAZOLINE-4-CARBOXYLIC ACID SODIUM SALT
CAS:Formula:C5H7NNaO2SPurity:97%Color and Shape:SolidMolecular weight:168.1693Sodium 2-Methyl-4,5-dihydro-1,3-thiazol-4-carboxylate
CAS:Controlled ProductFormula:C5H6NO2S·NaColor and Shape:NeatMolecular weight:167.16Sodium 2-Methyl-4,5-dihydro-1,3-thiazole-4-carboxylate (>90%)
CAS:Stability Hygroscopic
Applications Sodium 2-Methyl-4,5-dihydro-1,3-thiazole-4-carboxylate (CAS# 15058-19-2) is a useful reagent for preparing thiazoline and oxazoline substrates for FMN-containing oxidase domains of epothilone synthetase and bleomycin synthetase.
References Schneider, T. L., et al.: Biochemistry, 42, 9722 (2003)Formula:C5H6NO2S·NaPurity:>90%Color and Shape:NeatMolecular weight:167.16Sodium 2-methyl-4,5-dihydrothiazole-4-carboxylate
CAS:Sodium 2-methyl-4,5-dihydrothiazole-4-carboxylateFormula:C5H6NNaO2SPurity:97%Molecular weight:167.16Sodium 2-methyl-4,5-dihydro-1,3-thiazole-4-carboxylate
CAS:Versatile small molecule scaffoldFormula:C5H6NNaO2SPurity:Min. 95%Color and Shape:PowderMolecular weight:167.16 g/molSODIUM 2-METHYL-4,5-DIHYDRO-1,3-THIAZOLE-4-CARBOXYLATE
CAS:Purity:97%Color and Shape:SolidMolecular weight:167.1600037








