CAS 15062-88-1

2-hydrazino-1,3-benzoxazole

Description:

2-Hydrazino-1,3-benzoxazole is an organic compound characterized by the presence of both hydrazine and benzoxazole functional groups. It features a benzene ring fused to an oxazole ring, which is a five-membered heterocyclic structure containing nitrogen and oxygen. The hydrazino group (-NH-NH2) is attached to the benzoxazole, contributing to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydrazino group. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as well as in various chemical syntheses. The presence of nitrogen atoms in both the hydrazino and oxazole moieties can impart unique properties, such as the ability to form hydrogen bonds, which may influence its interactions in biological systems. Safety data should be consulted before handling, as compounds containing hydrazine derivatives can be hazardous.

Formula: C₇H₇N₃O

InChI: InChI=1/C7H7N3O/c8-10-7-9-5-3-1-2-4-6(5)11-7/h1-4H,8H2,(H,9,10)

SMILES: c1ccc2c(c1)nc(NN)o2

Synonyms:

• 2-Hydrazinyl-1,3-Benzoxazole

Benzoxazole, 2-hydrazinyl-

CAS: 15062-88-1

Formula: C₇H₇N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 149.1500

Ref: IN-DA001MSK

2-Hydrazino-1,3-benzoxazole

CAS: 15062-88-1

2-Hydrazino-1,3-benzoxazole

Formula: C₇H₇N₃O

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 149.15g/mol

Ref: 54-OR25941

2-Hydrazino-1,3-benzoxazole

Controlled Product

CAS: 15062-88-1

Applications 2-Hydrazino-1,3-benzoxazole

Formula: C₇H₇N₃O

Color and Shape: Neat

Molecular weight: 149.15

Ref: TR-H718003

2-Hydrazino-1,3-benzoxazole

CAS: 15062-88-1

Formula: C₇H₇N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 149.153

Ref: 10-F061297