
CAS 150645-86-6
:Poly(methylene blue)
Description:
Poly(methylene blue) is a synthetic polymeric dye derived from methylene blue, known for its distinctive blue color and various applications in biological and chemical fields. This substance exhibits excellent solubility in water, making it suitable for use in aqueous environments. Its structure consists of repeating units that contribute to its stability and functionality. Poly(methylene blue) is recognized for its ability to act as a redox mediator, which allows it to participate in electron transfer processes, making it valuable in electrochemical applications. Additionally, it has been studied for its potential in biomedical applications, including as a photosensitizer in photodynamic therapy and as a staining agent in histology. The polymer's biocompatibility and low toxicity further enhance its appeal for various uses, particularly in medical diagnostics and treatment. Overall, poly(methylene blue) is characterized by its vibrant color, solubility, stability, and versatility in both scientific research and practical applications.
Formula:(C16H18N3S·Cl)x
InChI:InChI=1S/C16H18N3S.ClH/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;/h5-10H,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=CXKWCBBOMKCUKX-UHFFFAOYSA-M
SMILES:N(C)(C)C1=CC2=C(N=C3C(=[S+]2)C=C(N(C)C)C=C3)C=C1.[Cl-]
Synonyms:- Methylene blue homopolymer
- Phenothiazin-5-ium, 3,7-bis(dimethylamino)-, chloride (1:1), homopolymer
- Phenothiazin-5-ium, 3,7-bis(dimethylamino)-, chloride, homopolymer
- Poly(methylene blue)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
