CAS 150679-23-5
:FK 906
Description:
FK 906, also known as a potent immunosuppressive agent, is characterized by its ability to inhibit the activation of T cells and the production of cytokines, making it significant in the context of organ transplantation and autoimmune diseases. It functions primarily as a selective inhibitor of the enzyme calcineurin, which plays a crucial role in T cell activation. FK 906 is structurally related to other immunosuppressants, exhibiting a complex molecular structure that contributes to its biological activity. The substance is typically administered in a controlled manner due to its potent effects and potential side effects, which can include increased susceptibility to infections and other complications associated with immunosuppression. Its pharmacokinetics involve metabolism primarily in the liver, and it is important to monitor drug levels to ensure therapeutic efficacy while minimizing toxicity. Overall, FK 906 represents a valuable tool in clinical settings where modulation of the immune response is necessary.
Formula:C40H64ClN7O7
InChI:InChI=1/C40H63N7O7.ClH/c1-29(2)16-17-35(48)33(24-30-12-8-6-9-13-30)43-37(49)34(26-32-27-41-28-42-32)46(5)38(50)36(25-31-14-10-7-11-15-31)54-40(52)45(4)19-18-44(3)39(51)47-20-22-53-23-21-47;/h7,10-11,14-15,27-30,33-36,48H,6,8-9,12-13,16-26H2,1-5H3,(H,41,42)(H,43,49);1H/t33?,34-,35?,36?;/m0./s1
Synonyms:- 1-Cyclohexyl-3-hydroxy-6-methyl-2-(N(alpha)-methyl-N(alpha)-(2-(N-methyl-N-(2-(N-methyl-N-morpholinocarbonylamino)ethyl)aminocarbonyloxy)-3-phenylpropionyl)histidyl)aminoheptane hydrochloride
- N-(1-cyclohexyl-3-hydroxy-6-methylheptan-2-yl)-Nalpha-methyl-Nalpha-{2-[(methyl{2-[methyl(morpholin-4-ylcarbonyl)amino]ethyl}carbamoyl)oxy]-3-phenylpropanoyl}-L-histidinamide hydrochloride (1:1)
- FK 906
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
FK-906 HCl
CAS:FK-906 HCl is a human renin inhibitor used for the long-term treatment of patients with essential hypertension.Formula:C40H64ClN7O7Color and Shape:SolidMolecular weight:790.44
