CymitQuimica logo

CAS 15069-43-9

:

5-Hexene-2,4-dione, 6-phenyl-

Description:
5-Hexene-2,4-dione, 6-phenyl- is an organic compound characterized by its dione functional groups, which indicate the presence of two carbonyl (C=O) groups within its structure. This compound features a hexene backbone, suggesting it has a six-carbon chain with a double bond, and a phenyl group, which is a benzene ring attached to the carbon chain. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis. Typically, compounds like this can exhibit properties such as being a liquid at room temperature, with varying degrees of solubility in organic solvents. The dione structure may also allow for tautomerism and various reaction pathways, including nucleophilic addition and condensation reactions. Additionally, the compound may have implications in fields such as pharmaceuticals or materials science, depending on its specific reactivity and interactions with other chemical species. Safety data should be consulted for handling and storage, as compounds with carbonyl groups can sometimes be reactive or hazardous.
Formula:C12H12O2
InChI:InChI=1S/C12H12O2/c1-10(13)9-12(14)8-7-11-5-3-2-4-6-11/h2-8H,9H2,1H3/b8-7+
InChI key:OOKUSDZYOMYKEJ-BQYQJAHWSA-N
SMILES:CC(=O)CC(=O)/C=C/C1=CC=CC=C1
Found 2 products.