CAS 15071-56-4
:5-Methoxycanthin-6-one
Description:
5-Methoxycanthin-6-one is a chemical compound belonging to the canthin alkaloid family, which is characterized by a fused tetracyclic structure. This compound features a methoxy group (-OCH3) at the 5-position and a ketone group (=O) at the 6-position of the canthin skeleton. It is typically recognized for its potential biological activities, including antimicrobial, anti-inflammatory, and anticancer properties, making it of interest in pharmaceutical research. The presence of the methoxy group can influence its solubility and reactivity, while the ketone functionality may participate in various chemical reactions, such as nucleophilic additions. 5-Methoxycanthin-6-one is often studied for its role in traditional medicine and its potential therapeutic applications. Its molecular structure contributes to its unique properties, and ongoing research continues to explore its mechanisms of action and efficacy in various biological systems. As with many alkaloids, safety and toxicity profiles are important considerations in its application and study.
Formula:C15H10N2O2
InChI:InChI=1S/C15H10N2O2/c1-19-13-8-11-14-10(6-7-16-11)9-4-2-3-5-12(9)17(14)15(13)18/h2-8H,1H3
InChI key:InChIKey=TXEFUSAHPIYZHD-UHFFFAOYSA-N
SMILES:O=C1N2C=3C(C=4C2=CC=CC4)=CC=NC3C=C1OC
Synonyms:- 5-Methoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one
- 6H-Indolo[3,2,1-de][1,5]naphthyridin-6-one, 5-methoxy-
- 5-Methoxycanthin-6-one
- NSC 88929
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
6H-Indolo[3,2,1-de][1,5]naphthyridin-6-one, 5-methoxy-
CAS:Formula:C15H10N2O2Purity:98.0%Molecular weight:250.25215-Methoxycanthin-6-one
CAS:5-Methoxycanthin-6-one shows moderate anti-cancer effects on PC-3 cells (IC50: 13.5-15.4 uM) and inhibits phagocytosis (IC50: 0.9-2.0 uM).Formula:C15H10N2O2Purity:98%Color and Shape:SolidMolecular weight:250.255-Methoxycanthin-6-one
CAS:5-Methoxycanthin-6-one is a naturally occurring alkaloid, which is derived from various plant sources, notably within the Rutaceae family. Its chemical structure classifies it as a canthinone, a type of indole alkaloid known for its complex heterocyclic framework. The mode of action for 5-Methoxycanthin-6-one involves interactions with biological targets such as enzymes, receptors, or nucleic acids, which may disrupt key cellular processes or signal transduction pathways. These interactions suggest its potential as a bioactive compound.
Formula:C15H10N2O2Purity:Min. 95%Molecular weight:250.25 g/mol


