CAS 150725-87-4
:4-tert-butyl-N-[6-(2-hydroxyethoxy)-5-(3-methoxyphenoxy)pyrimidin-4-yl]benzenesulfonamide
Description:
4-tert-butyl-N-[6-(2-hydroxyethoxy)-5-(3-methoxyphenoxy)pyrimidin-4-yl]benzenesulfonamide is a chemical compound characterized by its complex structure, which includes a sulfonamide group, a pyrimidine ring, and various substituents that enhance its solubility and biological activity. The presence of the tert-butyl group contributes to its hydrophobic characteristics, while the hydroxyethoxy and methoxyphenoxy groups increase its polarity and potential for interaction with biological targets. This compound is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where it may exhibit activity against specific enzymes or receptors. Its sulfonamide moiety is known for its role in various therapeutic applications, including antibacterial and diuretic effects. The compound's solubility, stability, and reactivity can be influenced by its functional groups, making it a subject of interest in drug development and formulation. Overall, its unique structural features suggest potential utility in various biochemical applications.
Formula:C23H27N3O6S
InChI:InChI=1/C23H27N3O6S/c1-23(2,3)16-8-10-19(11-9-16)33(28,29)26-21-20(22(25-15-24-21)31-13-12-27)32-18-7-5-6-17(14-18)30-4/h5-11,14-15,27H,12-13H2,1-4H3,(H,24,25,26)
SMILES:CC(C)(C)c1ccc(cc1)S(=O)(=O)Nc1c(c(ncn1)OCCO)Oc1cccc(c1)OC
Synonyms:- benzenesulfonamide, 4-(1,1-dimethylethyl)-N-[6-(2-hydroxyethoxy)-5-(3-methoxyphenoxy)-4-pyrimidinyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenesulfonamide, 4-(1,1-dimethylethyl)-N-[6-(2-hydroxyethoxy)-5-(3-methoxyphenoxy)-4-pyrimidinyl]-
CAS:Formula:C23H27N3O6SPurity:98%Color and Shape:SolidMolecular weight:473.5420Ro 46-2005
CAS:Ro 46-2005: Synthetic non-peptide, blocks 125I-ET-1 at ETA receptors on human vascular cells (IC50: 220 nM).Formula:C23H27N3O6SPurity:98.02% - 98.8%Color and Shape:SolidMolecular weight:473.54RO462005
CAS:RO462005 is a synthetic compound that has been shown to have physiological effects on cardiac tissues and the cardiovascular system. It binds to the receptor of the G-protein, which is coupled to a phospholipase C (PLC) cascade. RO462005 activates PLC, which leads to an increase in intracellular calcium levels and activation of protein kinase C (PKC). This activity leads to vasodilation and increased blood flow. RO462005 has been shown to inhibit transcription-polymerase chain reaction (PCR) by binding to RNA polymerase II, inhibiting transcription of messenger ribonucleic acid (mRNA). It inhibits proliferation of human colon adenocarcinoma cells (CCaco-2) in vitro by binding with high affinity to their PDE4D5 receptor. RO462005 also increases contractions in vitro in response to acetylcholine or potassium chloride by stimulating muscarinic receptors on ileal smooth muscle cells fromFormula:C23H27N3O6SPurity:Min. 95%Molecular weight:473.54 g/mol



