
CAS 15073-80-0
:3-Methoxy-α-methyltyrosine
Description:
3-Methoxy-α-methyltyrosine, also known as methoxytyrosine, is an aromatic amino acid derivative characterized by the presence of a methoxy group attached to the phenolic ring of tyrosine. Its chemical structure features a methyl group at the alpha position relative to the amino group, which contributes to its unique properties. This compound is often studied for its role in biochemical pathways, particularly in the synthesis of catecholamines, as it can act as an inhibitor of tyrosine hydroxylase, the enzyme responsible for the conversion of tyrosine to L-DOPA. 3-Methoxy-α-methyltyrosine is soluble in organic solvents and exhibits moderate stability under standard laboratory conditions. It is of interest in pharmacological research, particularly in the context of neurochemistry and potential therapeutic applications. Additionally, its CAS number, 15073-80-0, is used for identification in chemical databases and regulatory frameworks. Overall, this compound serves as a valuable tool in understanding metabolic processes and the regulation of neurotransmitter synthesis.
Formula:C11H15NO4
InChI:InChI=1S/C11H15NO4/c1-11(12,10(14)15)6-7-3-4-8(13)9(5-7)16-2/h3-5,13H,6,12H2,1-2H3,(H,14,15)
InChI key:InChIKey=BQHWFYPBSKGBMV-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)(C)N)C1=CC(OC)=C(O)C=C1
Synonyms:- Tyrosine, 3-methoxy-α-methyl-
- Tyrosine, 3-methoxy-α-methyl-, DL-
- DL-Tyrosine, 3-methoxy-α-methyl-
- 3-Methoxy-α-methyltyrosine
- DL-3-O-Methyl-α-methyldopa
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
