
CAS 1507370-54-8
:(1α,8α,9α)-Bicyclo[6.1.0]non-4-yn-9-ylmethyl 12-[6-[2-(1-methylethylidene)hydrazinyl]-3-pyridinyl]-12-oxo-5,8-dioxa-2,11-diazadodecanoate
Description:
The chemical substance with the name "(1α,8α,9α)-Bicyclo[6.1.0]non-4-yn-9-ylmethyl 12-[6-[2-(1-methylethylidene)hydrazinyl]-3-pyridinyl]-12-oxo-5,8-dioxa-2,11-diazadodecanoate" and CAS number 1507370-54-8 is a complex organic compound characterized by its bicyclic structure and multiple functional groups. It features a bicyclo[6.1.0] framework, which contributes to its unique three-dimensional shape and potential reactivity. The presence of a hydrazine moiety suggests possible biological activity, as hydrazines are often associated with various pharmacological properties. Additionally, the compound contains a pyridine ring, which can enhance its interaction with biological targets due to the nitrogen atom's ability to participate in hydrogen bonding and coordination. The ester functional group indicates potential for hydrolysis, which may influence its stability and solubility in biological systems. Overall, this compound's intricate structure and diverse functional groups may render it of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.
Formula:C26H37N5O5
InChI:InChI=1/C26H37N5O5/c1-19(2)30-31-24-10-9-20(17-29-24)25(32)27-11-13-34-15-16-35-14-12-28-26(33)36-18-23-21-7-5-3-4-6-8-22(21)23/h9-10,17,21-23H,5-8,11-16,18H2,1-2H3,(H,27,32)(H,28,33)(H,29,31)/t21-,22+,23+
InChI key:InChIKey=WUZIJQCMBXWWON-JKHIJQBDNA-N
SMILES:C(OC(NCCOCCOCCNC(=O)C=1C=CC(NN=C(C)C)=NC1)=O)[C@H]2[C@]3([C@@]2(CCC#CCC3)[H])[H]
Synonyms:- 5,8-Dioxa-2,11-diazadodecanoic acid, 12-[6-[2-(1-methylethylidene)hydrazinyl]-3-pyridinyl]-12-oxo-, (1α,8α,9α)-bicyclo[6.1.0]non-4-yn-9-ylmethyl ester
- (1α,8α,9α)-Bicyclo[6.1.0]non-4-yn-9-ylmethyl 12-[6-[2-(1-methylethylidene)hydrazinyl]-3-pyridinyl]-12-oxo-5,8-dioxa-2,11-diazadodecanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
BCN-PEG4-HyNic
CAS:BCN-PEG4-HyNic is a cleavable four-unit PEG linker utilized in ADC synthesis for coupling drugs to antibodies, creating antibody-drug conjugates (ADCs).Formula:C26H2N5O5Color and Shape:SolidMolecular weight:464.32
