CAS 15074-20-1
:4-Hydroxy-3-(1-phenylethyl)-2H-1-benzopyran-2-one
Description:
4-Hydroxy-3-(1-phenylethyl)-2H-1-benzopyran-2-one, commonly known as a flavonoid compound, exhibits several notable characteristics. It features a benzopyran structure, which is typical of flavonoids, contributing to its potential biological activities. The presence of a hydroxy group enhances its antioxidant properties, making it a subject of interest in pharmacological research. The phenylethyl substituent may influence its interaction with biological targets, potentially affecting its efficacy in various applications, including anti-inflammatory and anticancer activities. This compound is typically soluble in organic solvents and may exhibit limited solubility in water, which is common for many flavonoids. Its molecular structure allows for various chemical modifications, which can lead to derivatives with enhanced or altered biological activities. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and light exposure. Overall, 4-Hydroxy-3-(1-phenylethyl)-2H-1-benzopyran-2-one represents a significant compound in the study of natural products and their therapeutic potentials.
Formula:C17H14O3
InChI:InChI=1S/C17H14O3/c1-11(12-7-3-2-4-8-12)15-16(18)13-9-5-6-10-14(13)20-17(15)19/h2-11,18H,1H3
InChI key:InChIKey=ZCQSVTPIFUGZOW-UHFFFAOYSA-N
SMILES:C(C)(C1=C(O)C=2C(OC1=O)=CC=CC2)C3=CC=CC=C3
Synonyms:- 4-Hydroxy-3-(1-phenylethyl)-2H-1-benzopyran-2-one
- Coumarin, 4-hydroxy-3-(α-methylbenzyl)-
- 2H-1-Benzopyran-2-one, 4-hydroxy-3-(1-phenylethyl)-
- 3-(α-Phenylethyl)-4-hydroxycoumarin
- Phenprocoumon Impurity 1
- Phenprocoumon Impurity 4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
