CAS 150780-40-8

6-Bromo-2-trifluoromethylimidazo[1,2-a]pyridine

Description:

6-Bromo-2-trifluoromethylimidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its imidazo[1,2-a]pyridine structure, which incorporates a bromine atom and a trifluoromethyl group. This compound features a fused bicyclic system that contributes to its unique chemical properties. The presence of the bromine atom enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The trifluoromethyl group is known for its electron-withdrawing properties, which can significantly influence the compound's reactivity and stability. This substance is of interest in medicinal chemistry and material science due to its potential biological activity and applications in the development of pharmaceuticals. Additionally, its structural characteristics may impart specific physical properties, such as solubility and melting point, which are important for its practical applications. Overall, 6-Bromo-2-trifluoromethylimidazo[1,2-a]pyridine is a versatile compound with significant implications in various fields of research.

Formula: C₈H₄BrF₃N₂

InChI: InChI=1/C8H4BrF3N2/c9-5-1-2-7-13-6(8(10,11)12)4-14(7)3-5/h1-4H

SMILES: c1cc2nc(cn2cc1Br)C(F)(F)F

Synonyms:

• 6-Bromo-2-(trifluoromethyl)imidazo[1,2-a]pyridine
• Imidazo[1,2-A]Pyridine, 6-Bromo-2-(Trifluoromethyl)-

IMIDAZO[1,2-A]PYRIDINE, 6-BROMO-2-(TRIFLUOROMETHYL)-

CAS: 150780-40-8

Formula: C₈H₄BrF₃N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 265.0300

Ref: IN-DA001MV0

6-Bromo-2-(trifluoromethyl)imidazo[1,2-a]pyridine

CAS: 150780-40-8

6-Bromo-2-(trifluoromethyl)imidazo[1,2-a]pyridine

Formula: C₈H₄BrF₃N₂

Purity: 98%

Color and Shape: Powder

Molecular weight: 265.03g/mol

Ref: 54-PC6141

6-Bromo-2-trifluoromethylimidazo[1,2-a]pyridine

CAS: 150780-40-8

Purity: 98%

Molecular weight: 265.0329895

Ref: 10-F788043