CAS 1508-90-3

7-hydroxy-3-(4-methoxyphenyl)-4-phenyl-2H-chromen-2-one

Description:

7-Hydroxy-3-(4-methoxyphenyl)-4-phenyl-2H-chromen-2-one, also known by its CAS number 1508-90-3, is a synthetic compound belonging to the flavonoid class, specifically a type of chromone. This compound features a chromone backbone, characterized by a benzopyran structure, which is substituted at various positions. The presence of a hydroxyl group at the 7-position and a methoxyphenyl group at the 3-position contributes to its potential biological activity, including antioxidant and anti-inflammatory properties. The additional phenyl group at the 4-position enhances its structural complexity and may influence its solubility and reactivity. This compound is of interest in medicinal chemistry and pharmacology due to its potential therapeutic applications. Its properties, such as solubility, stability, and reactivity, can vary based on the specific conditions and solvents used. Overall, 7-hydroxy-3-(4-methoxyphenyl)-4-phenyl-2H-chromen-2-one represents a valuable compound for further research in the fields of biochemistry and drug development.

Formula: C₂₂H₁₆O₄

InChI: InChI=1/C22H16O4/c1-25-17-10-7-15(8-11-17)21-20(14-5-3-2-4-6-14)18-12-9-16(23)13-19(18)26-22(21)24/h2-13,23H,1H3

SMILES: COc1ccc(cc1)c1c(c2ccccc2)c2ccc(cc2oc1=O)O

7-Hydroxy-3-(4’-methoxyphenyl)-4-phenylcoumarin

CAS: 1508-90-3

7-Hydroxy-3-(4’-methoxyphenyl)-4-phenylcoumarin

Purity: ≥95%

Molecular weight: 344.36g/mol

Ref: 54-OR351046