CAS 150812-33-2
:2,4-Dibromo-5-chlorobenzoic acid
Description:
2,4-Dibromo-5-chlorobenzoic acid is an aromatic carboxylic acid characterized by the presence of two bromine atoms and one chlorine atom substituted on a benzoic acid framework. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, while its solubility in water is limited. The presence of halogen substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The carboxylic acid functional group imparts acidic properties, allowing it to participate in acid-base reactions. Additionally, the compound may exhibit biological activity, which can be of interest in pharmaceutical and agrochemical research. Its molecular structure contributes to its potential applications in synthesis and as an intermediate in the production of other chemical compounds. Safety data should be consulted for handling and disposal, as halogenated compounds can pose environmental and health risks.
Formula:C7H3Br2ClO2
InChI:InChI=1S/C7H3Br2ClO2/c8-4-2-5(9)6(10)1-3(4)7(11)12/h1-2H,(H,11,12)
InChI key:InChIKey=BHWZSQKCDWJPSY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Br)C=C(Br)C(Cl)=C1
Synonyms:- Benzoic acid, 2,4-dibromo-5-chloro-
- 2,4-Dibromo-5-chlorobenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
